C19H28N2O2S — CID 98606974
3-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-[(4-ethoxy-3-methoxyphenyl)methyl]-1-methylthiourea (PubChem CID 98606974) has the molecular formula C19H28N2O2S and a molecular weight of 348.51 g/mol. Its IUPAC name is 3-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-[(4-ethoxy-3-methoxyphenyl)methyl]-1-methylthiourea.
| Compound Name | 3-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-[(4-ethoxy-3-methoxyphenyl)methyl]-1-methylthiourea |
|---|---|
| PubChem CID | 98606974 |
| Molecular Formula | C19H28N2O2S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 3-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-[(4-ethoxy-3-methoxyphenyl)methyl]-1-methylthiourea |
| SMILES | CCOc1ccc(CN(C)C(=S)N[C@@H]2C[C@H]3CC[C@H]2C3)cc1OC |
| InChI | InChI=1S/C19H28N2O2S/c1-4-23-17-8-6-14(11-18(17)22-3)12-21(2)19(24)20-16-10-13-5-7-15(16)9-13/h6,8,11,13,15-16H,4-5,7,9-10,12H2,1-3H3,(H,20,24)/t13-,15-,16+/m0/s1 |
| InChIKey | XEDMIMPSAZSBGB-CWRNSKLLSA-N |
| XLogP | 3.59 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|