C21H25FN2O6 — CID 98613327
[(2R)-1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl] 2-[(5R,7R)-3-hydroxy-1-adamantyl]acetate (PubChem CID 98613327) has the molecular formula C21H25FN2O6 and a molecular weight of 420.44 g/mol. Its IUPAC name is [(2R)-1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl] 2-[(5R,7R)-3-hydroxy-1-adamantyl]acetate.
| Compound Name | [(2R)-1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl] 2-[(5R,7R)-3-hydroxy-1-adamantyl]acetate |
|---|---|
| PubChem CID | 98613327 |
| Molecular Formula | C21H25FN2O6 |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | [(2R)-1-(4-fluoro-3-nitroanilino)-1-oxopropan-2-yl] 2-[(5R,7R)-3-hydroxy-1-adamantyl]acetate |
| SMILES | C[C@@H](OC(=O)CC12C[C@H]3C[C@@H](CC(O)(C3)C1)C2)C(=O)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H25FN2O6/c1-12(19(26)23-15-2-3-16(22)17(5-15)24(28)29)30-18(25)10-20-6-13-4-14(7-20)9-21(27,8-13)11-20/h2-3,5,12-14,27H,4,6-11H2,1H3,(H,23,26)/t12-,13-,14-,20?,21?/m1/s1 |
| InChIKey | ATCPTFFRGRUOTI-NZBQLKCUSA-N |
| XLogP | 3.33 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|