C24H18N4O3S — CID 98614276
N-[4-[(E)-2-amino-1-cyanoprop-1-enyl]-1,3-thiazol-2-yl]-3-methyl-4-oxo-2-phenylchromene-8-carboxamide (PubChem CID 98614276) has the molecular formula C24H18N4O3S and a molecular weight of 442.50 g/mol. Its IUPAC name is N-[4-[(E)-2-amino-1-cyanoprop-1-enyl]-1,3-thiazol-2-yl]-3-methyl-4-oxo-2-phenylchromene-8-carboxamide.
| Compound Name | N-[4-[(E)-2-amino-1-cyanoprop-1-enyl]-1,3-thiazol-2-yl]-3-methyl-4-oxo-2-phenylchromene-8-carboxamide |
|---|---|
| PubChem CID | 98614276 |
| Molecular Formula | C24H18N4O3S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | N-[4-[(E)-2-amino-1-cyanoprop-1-enyl]-1,3-thiazol-2-yl]-3-methyl-4-oxo-2-phenylchromene-8-carboxamide |
| SMILES | C/C(N)=C(\C#N)c1csc(NC(=O)c2cccc3c(=O)c(C)c(-c4ccccc4)oc23)n1 |
| InChI | InChI=1S/C24H18N4O3S/c1-13-20(29)16-9-6-10-17(22(16)31-21(13)15-7-4-3-5-8-15)23(30)28-24-27-19(12-32-24)18(11-25)14(2)26/h3-10,12H,26H2,1-2H3,(H,27,28,30)/b18-14- |
| InChIKey | CDEMVDDEAZYNTO-JXAWBTAJSA-N |
| XLogP | 4.69 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|