C20H29N5O2 — CID 98688861
N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2-(4-oxo-7,8,9,10-tetrahydro-6H-purino[9,8-a]azepin-3-yl)acetamide (PubChem CID 98688861) has the molecular formula C20H29N5O2 and a molecular weight of 371.49 g/mol. Its IUPAC name is N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2-(4-oxo-7,8,9,10-tetrahydro-6H-purino[9,8-a]azepin-3-yl)acetamide.
| Compound Name | N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2-(4-oxo-7,8,9,10-tetrahydro-6H-purino[9,8-a]azepin-3-yl)acetamide |
|---|---|
| PubChem CID | 98688861 |
| Molecular Formula | C20H29N5O2 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2-(4-oxo-7,8,9,10-tetrahydro-6H-purino[9,8-a]azepin-3-yl)acetamide |
| SMILES | C[C@H]1[C@H](C)CCC[C@H]1NC(=O)Cn1cnc2c(nc3n2CCCCC3)c1=O |
| InChI | InChI=1S/C20H29N5O2/c1-13-7-6-8-15(14(13)2)22-17(26)11-24-12-21-19-18(20(24)27)23-16-9-4-3-5-10-25(16)19/h12-15H,3-11H2,1-2H3,(H,22,26)/t13-,14+,15-/m1/s1 |
| InChIKey | YFQQPJGAAAXPSY-QLFBSQMISA-N |
| XLogP | 2.26 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |