C26H33N5O2S — CID 16526466
N-(2,3-dimethylcyclohexyl)-2-[(3-oxo-4-phenyl-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-8-yl)sulfanyl]acetamide (PubChem CID 16526466) has the molecular formula C26H33N5O2S and a molecular weight of 479.65 g/mol. Its IUPAC name is N-(2,3-dimethylcyclohexyl)-2-[(3-oxo-4-phenyl-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-8-yl)sulfanyl]acetamide.
| Compound Name | N-(2,3-dimethylcyclohexyl)-2-[(3-oxo-4-phenyl-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-8-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 16526466 |
| Molecular Formula | C26H33N5O2S |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | N-(2,3-dimethylcyclohexyl)-2-[(3-oxo-4-phenyl-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-8-yl)sulfanyl]acetamide |
| SMILES | CC1CCCC(NC(=O)CSc2nc3nn(-c4ccccc4)c(=O)c-3c3n2CCCCC3)C1C |
| InChI | InChI=1S/C26H33N5O2S/c1-17-10-9-13-20(18(17)2)27-22(32)16-34-26-28-24-23(21-14-7-4-8-15-30(21)26)25(33)31(29-24)19-11-5-3-6-12-19/h3,5-6,11-12,17-18,20H,4,7-10,13-16H2,1-2H3,(H,27,32) |
| InChIKey | HAPUPNXJASCBGR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |