C28H29N5O2S — CID 46668905
8-[2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-4-phenyl-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-3-one (PubChem CID 46668905) has the molecular formula C28H29N5O2S and a molecular weight of 499.64 g/mol. Its IUPAC name is 8-[2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-4-phenyl-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-3-one.
| Compound Name | 8-[2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-4-phenyl-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-3-one |
|---|---|
| PubChem CID | 46668905 |
| Molecular Formula | C28H29N5O2S |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | 8-[2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-4-phenyl-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-3-one |
| SMILES | CC1CCc2ccccc2N1C(=O)CSc1nc2nn(-c3ccccc3)c(=O)c-2c2n1CCCCC2 |
| InChI | InChI=1S/C28H29N5O2S/c1-19-15-16-20-10-7-8-13-22(20)32(19)24(34)18-36-28-29-26-25(23-14-6-3-9-17-31(23)28)27(35)33(30-26)21-11-4-2-5-12-21/h2,4-5,7-8,10-13,19H,3,6,9,14-18H2,1H3 |
| InChIKey | BPLKYNKLYPZENW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |