C23H22N4OS — CID 16526429
8-benzylsulfanyl-4-phenyl-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-3-one (PubChem CID 16526429) has the molecular formula C23H22N4OS and a molecular weight of 402.52 g/mol. Its IUPAC name is 8-benzylsulfanyl-4-phenyl-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-3-one.
| Compound Name | 8-benzylsulfanyl-4-phenyl-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-3-one |
|---|---|
| PubChem CID | 16526429 |
| Molecular Formula | C23H22N4OS |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 8-benzylsulfanyl-4-phenyl-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-3-one |
| SMILES | O=c1c2c3n(c(SCc4ccccc4)nc-2nn1-c1ccccc1)CCCCC3 |
| InChI | InChI=1S/C23H22N4OS/c28-22-20-19-14-8-3-9-15-26(19)23(29-16-17-10-4-1-5-11-17)24-21(20)25-27(22)18-12-6-2-7-13-18/h1-2,4-7,10-13H,3,8-9,14-16H2 |
| InChIKey | TYUQGRDKBFBOGG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |