C19H22N4O2S — CID 46648166
8-(2-methoxyethylsulfanyl)-4-phenyl-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-3-one (PubChem CID 46648166) has the molecular formula C19H22N4O2S and a molecular weight of 370.48 g/mol. Its IUPAC name is 8-(2-methoxyethylsulfanyl)-4-phenyl-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-3-one.
| Compound Name | 8-(2-methoxyethylsulfanyl)-4-phenyl-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-3-one |
|---|---|
| PubChem CID | 46648166 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 8-(2-methoxyethylsulfanyl)-4-phenyl-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-3-one |
| SMILES | COCCSc1nc2nn(-c3ccccc3)c(=O)c-2c2n1CCCCC2 |
| InChI | InChI=1S/C19H22N4O2S/c1-25-12-13-26-19-20-17-16(15-10-6-3-7-11-22(15)19)18(24)23(21-17)14-8-4-2-5-9-14/h2,4-5,8-9H,3,6-7,10-13H2,1H3 |
| InChIKey | FZTHBJKKPFEWQS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|