C21H23N5OS — CID 112779100
5-[(3-oxo-4-phenyl-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-8-yl)sulfanyl]pentanenitrile (PubChem CID 112779100) has the molecular formula C21H23N5OS and a molecular weight of 393.52 g/mol. Its IUPAC name is 5-[(3-oxo-4-phenyl-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-8-yl)sulfanyl]pentanenitrile.
| Compound Name | 5-[(3-oxo-4-phenyl-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-8-yl)sulfanyl]pentanenitrile |
|---|---|
| PubChem CID | 112779100 |
| Molecular Formula | C21H23N5OS |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 5-[(3-oxo-4-phenyl-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-8-yl)sulfanyl]pentanenitrile |
| SMILES | N#CCCCCSc1nc2nn(-c3ccccc3)c(=O)c-2c2n1CCCCC2 |
| InChI | InChI=1S/C21H23N5OS/c22-13-7-3-9-15-28-21-23-19-18(17-12-6-2-8-14-25(17)21)20(27)26(24-19)16-10-4-1-5-11-16/h1,4-5,10-11H,2-3,6-9,12,14-15H2 |
| InChIKey | PPRNEYRWAJGPMA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 76.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|