C26H25N5O2S — CID 4856687
8-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-4-phenyl-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-3-one (PubChem CID 4856687) has the molecular formula C26H25N5O2S and a molecular weight of 471.59 g/mol. Its IUPAC name is 8-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-4-phenyl-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-3-one.
| Compound Name | 8-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-4-phenyl-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-3-one |
|---|---|
| PubChem CID | 4856687 |
| Molecular Formula | C26H25N5O2S |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 8-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-4-phenyl-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-3-one |
| SMILES | O=C(CSc1nc2nn(-c3ccccc3)c(=O)c-2c2n1CCCCC2)N1CCc2ccccc21 |
| InChI | InChI=1S/C26H25N5O2S/c32-22(29-16-14-18-9-6-7-12-20(18)29)17-34-26-27-24-23(21-13-5-2-8-15-30(21)26)25(33)31(28-24)19-10-3-1-4-11-19/h1,3-4,6-7,9-12H,2,5,8,13-17H2 |
| InChIKey | MQGADBUQPYSKEP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |