C25H31N5O2S — CID 16526465
N-(cyclohexylmethyl)-2-[(3-oxo-4-phenyl-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-8-yl)sulfanyl]acetamide (PubChem CID 16526465) has the molecular formula C25H31N5O2S and a molecular weight of 465.62 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2-[(3-oxo-4-phenyl-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-8-yl)sulfanyl]acetamide.
| Compound Name | N-(cyclohexylmethyl)-2-[(3-oxo-4-phenyl-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-8-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 16526465 |
| Molecular Formula | C25H31N5O2S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | N-(cyclohexylmethyl)-2-[(3-oxo-4-phenyl-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-8-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nc2nn(-c3ccccc3)c(=O)c-2c2n1CCCCC2)NCC1CCCCC1 |
| InChI | InChI=1S/C25H31N5O2S/c31-21(26-16-18-10-4-1-5-11-18)17-33-25-27-23-22(20-14-8-3-9-15-29(20)25)24(32)30(28-23)19-12-6-2-7-13-19/h2,6-7,12-13,18H,1,3-5,8-11,14-17H2,(H,26,31) |
| InChIKey | MNTVIIQWCBDFKO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |