C27H33N5O2S — CID 98750774
N-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-[(3-oxo-4-phenyl-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-8-yl)sulfanyl]acetamide (PubChem CID 98750774) has the molecular formula C27H33N5O2S and a molecular weight of 491.66 g/mol. Its IUPAC name is N-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-[(3-oxo-4-phenyl-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-8-yl)sulfanyl]acetamide.
| Compound Name | N-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-[(3-oxo-4-phenyl-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-8-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 98750774 |
| Molecular Formula | C27H33N5O2S |
| Molecular Weight | 491.66 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | N-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-[(3-oxo-4-phenyl-4,5,7,9-tetrazatricyclo[7.5.0.02,6]tetradeca-1,5,7-trien-8-yl)sulfanyl]acetamide |
| SMILES | C[C@@H](NC(=O)CSc1nc2nn(-c3ccccc3)c(=O)c-2c2n1CCCCC2)[C@@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C27H33N5O2S/c1-17(21-15-18-11-12-19(21)14-18)28-23(33)16-35-27-29-25-24(22-10-6-3-7-13-31(22)27)26(34)32(30-25)20-8-4-2-5-9-20/h2,4-5,8-9,17-19,21H,3,6-7,10-16H2,1H3,(H,28,33)/t17-,18+,19+,21+/m1/s1 |
| InChIKey | YRQLSGXDCVWWPF-JKBKZWBZSA-N |
| XLogP | 4.29 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.66 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |