C18H24N4O4 — CID 98727860
(2R)-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-[2-(3-nitrophenyl)imidazol-1-yl]propan-2-ol (PubChem CID 98727860) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is (2R)-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-[2-(3-nitrophenyl)imidazol-1-yl]propan-2-ol.
| Compound Name | (2R)-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-[2-(3-nitrophenyl)imidazol-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 98727860 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | (2R)-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-[2-(3-nitrophenyl)imidazol-1-yl]propan-2-ol |
| SMILES | C[C@@H]1CN(C[C@@H](O)Cn2ccnc2-c2cccc([N+](=O)[O-])c2)C[C@@H](C)O1 |
| InChI | InChI=1S/C18H24N4O4/c1-13-9-20(10-14(2)26-13)11-17(23)12-21-7-6-19-18(21)15-4-3-5-16(8-15)22(24)25/h3-8,13-14,17,23H,9-12H2,1-2H3/t13-,14-,17-/m1/s1 |
| InChIKey | SXUSGEADOUPGAU-CKEIUWERSA-N |
| XLogP | 1.93 |
| TPSA | 93.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|