C17H13F2N3O3 — CID 94333678
(1R)-1-(2,5-difluorophenyl)-2-[2-(3-nitrophenyl)imidazol-1-yl]ethanol (PubChem CID 94333678) has the molecular formula C17H13F2N3O3 and a molecular weight of 345.31 g/mol. Its IUPAC name is (1R)-1-(2,5-difluorophenyl)-2-[2-(3-nitrophenyl)imidazol-1-yl]ethanol.
| Compound Name | (1R)-1-(2,5-difluorophenyl)-2-[2-(3-nitrophenyl)imidazol-1-yl]ethanol |
|---|---|
| PubChem CID | 94333678 |
| Molecular Formula | C17H13F2N3O3 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | (1R)-1-(2,5-difluorophenyl)-2-[2-(3-nitrophenyl)imidazol-1-yl]ethanol |
| SMILES | O=[N+]([O-])c1cccc(-c2nccn2C[C@H](O)c2cc(F)ccc2F)c1 |
| InChI | InChI=1S/C17H13F2N3O3/c18-12-4-5-15(19)14(9-12)16(23)10-21-7-6-20-17(21)11-2-1-3-13(8-11)22(24)25/h1-9,16,23H,10H2/t16-/m0/s1 |
| InChIKey | BVKIRNFNFXJWEV-INIZCTEOSA-N |
| XLogP | 3.47 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|