C16H21N3O3S — CID 98750623
(2S,5S)-4-(1-benzylpyrazol-4-yl)sulfonyl-2,5-dimethylmorpholine (PubChem CID 98750623) has the molecular formula C16H21N3O3S and a molecular weight of 335.43 g/mol. Its IUPAC name is (2S,5S)-4-(1-benzylpyrazol-4-yl)sulfonyl-2,5-dimethylmorpholine.
| Compound Name | (2S,5S)-4-(1-benzylpyrazol-4-yl)sulfonyl-2,5-dimethylmorpholine |
|---|---|
| PubChem CID | 98750623 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | (2S,5S)-4-(1-benzylpyrazol-4-yl)sulfonyl-2,5-dimethylmorpholine |
| SMILES | C[C@H]1CN(S(=O)(=O)c2cnn(Cc3ccccc3)c2)[C@@H](C)CO1 |
| InChI | InChI=1S/C16H21N3O3S/c1-13-12-22-14(2)9-19(13)23(20,21)16-8-17-18(11-16)10-15-6-4-3-5-7-15/h3-8,11,13-14H,9-10,12H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | HTDYKVKROVPYPK-KBPBESRZSA-N |
| XLogP | 1.73 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |