C17H24N4O2S — CID 124689676
(1R)-1-[(2S)-1-(1-benzylpyrazol-4-yl)sulfonylpiperidin-2-yl]ethanamine (PubChem CID 124689676) has the molecular formula C17H24N4O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is (1R)-1-[(2S)-1-(1-benzylpyrazol-4-yl)sulfonylpiperidin-2-yl]ethanamine.
| Compound Name | (1R)-1-[(2S)-1-(1-benzylpyrazol-4-yl)sulfonylpiperidin-2-yl]ethanamine |
|---|---|
| PubChem CID | 124689676 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (1R)-1-[(2S)-1-(1-benzylpyrazol-4-yl)sulfonylpiperidin-2-yl]ethanamine |
| SMILES | C[C@@H](N)[C@@H]1CCCCN1S(=O)(=O)c1cnn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C17H24N4O2S/c1-14(18)17-9-5-6-10-21(17)24(22,23)16-11-19-20(13-16)12-15-7-3-2-4-8-15/h2-4,7-8,11,13-14,17H,5-6,9-10,12,18H2,1H3/t14-,17+/m1/s1 |
| InChIKey | FQUADINPGBRKGC-PBHICJAKSA-N |
| XLogP | 1.82 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |