C17H19FN4O — CID 98777113
(7R,8aS)-7-(3-fluorophenoxy)-2-pyrimidin-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 98777113) has the molecular formula C17H19FN4O and a molecular weight of 314.36 g/mol. Its IUPAC name is (7R,8aS)-7-(3-fluorophenoxy)-2-pyrimidin-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (7R,8aS)-7-(3-fluorophenoxy)-2-pyrimidin-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 98777113 |
| Molecular Formula | C17H19FN4O |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | (7R,8aS)-7-(3-fluorophenoxy)-2-pyrimidin-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | Fc1cccc(O[C@@H]2C[C@H]3CN(c4ncccn4)CCN3C2)c1 |
| InChI | InChI=1S/C17H19FN4O/c18-13-3-1-4-15(9-13)23-16-10-14-11-22(8-7-21(14)12-16)17-19-5-2-6-20-17/h1-6,9,14,16H,7-8,10-12H2/t14-,16+/m0/s1 |
| InChIKey | RJSSJYSXLGEGGV-GOEBONIOSA-N |
| XLogP | 1.96 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |