C15H17N5O3 — CID 98777221
[(3aR,6aS)-1-(6-methoxypyrimidin-4-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(1,2-oxazol-5-yl)methanone (PubChem CID 98777221) has the molecular formula C15H17N5O3 and a molecular weight of 315.33 g/mol. Its IUPAC name is [(3aR,6aS)-1-(6-methoxypyrimidin-4-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(1,2-oxazol-5-yl)methanone.
| Compound Name | [(3aR,6aS)-1-(6-methoxypyrimidin-4-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(1,2-oxazol-5-yl)methanone |
|---|---|
| PubChem CID | 98777221 |
| Molecular Formula | C15H17N5O3 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | [(3aR,6aS)-1-(6-methoxypyrimidin-4-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(1,2-oxazol-5-yl)methanone |
| SMILES | COc1cc(N2CC[C@@H]3[C@@H]2CCN3C(=O)c2ccno2)ncn1 |
| InChI | InChI=1S/C15H17N5O3/c1-22-14-8-13(16-9-17-14)19-6-3-11-10(19)4-7-20(11)15(21)12-2-5-18-23-12/h2,5,8-11H,3-4,6-7H2,1H3/t10-,11+/m0/s1 |
| InChIKey | PJSPJNGRXFNNRD-WDEREUQCSA-N |
| XLogP | 0.97 |
| TPSA | 84.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |