C17H24N4O4 — CID 155902077
[(3aR,5R,7aR)-1-(6-methoxypyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-morpholin-4-ylmethanone (PubChem CID 155902077) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is [(3aR,5R,7aR)-1-(6-methoxypyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-morpholin-4-ylmethanone.
| Compound Name | [(3aR,5R,7aR)-1-(6-methoxypyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 155902077 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | [(3aR,5R,7aR)-1-(6-methoxypyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-morpholin-4-ylmethanone |
| SMILES | COc1cc(N2CC[C@H]3O[C@@H](C(=O)N4CCOCC4)CC[C@H]32)ncn1 |
| InChI | InChI=1S/C17H24N4O4/c1-23-16-10-15(18-11-19-16)21-5-4-13-12(21)2-3-14(25-13)17(22)20-6-8-24-9-7-20/h10-14H,2-9H2,1H3/t12-,13-,14-/m1/s1 |
| InChIKey | NAMXDFVIRRSLGZ-MGPQQGTHSA-N |
| XLogP | 0.47 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |