C18H24FN3O3 — CID 98777308
[(1R,3aR,7aR)-1-(morpholin-4-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-(3-fluoro-4-pyridinyl)methanone (PubChem CID 98777308) has the molecular formula C18H24FN3O3 and a molecular weight of 349.41 g/mol. Its IUPAC name is [(1R,3aR,7aR)-1-(morpholin-4-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-(3-fluoro-4-pyridinyl)methanone.
| Compound Name | [(1R,3aR,7aR)-1-(morpholin-4-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-(3-fluoro-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 98777308 |
| Molecular Formula | C18H24FN3O3 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | [(1R,3aR,7aR)-1-(morpholin-4-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-(3-fluoro-4-pyridinyl)methanone |
| SMILES | O=C(c1ccncc1F)N1CC[C@@H]2[C@@H](CO[C@H]2CN2CCOCC2)C1 |
| InChI | InChI=1S/C18H24FN3O3/c19-16-9-20-3-1-15(16)18(23)22-4-2-14-13(10-22)12-25-17(14)11-21-5-7-24-8-6-21/h1,3,9,13-14,17H,2,4-8,10-12H2/t13-,14-,17+/m1/s1 |
| InChIKey | YGVYLVYSPBDTAE-CPUCHLNUSA-N |
| XLogP | 1.03 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |