C18H22N2O3 — CID 98785750
5-(furan-2-yl)-N-[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-1,2-oxazole-3-carboxamide (PubChem CID 98785750) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is 5-(furan-2-yl)-N-[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(furan-2-yl)-N-[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 98785750 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 5-(furan-2-yl)-N-[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-1,2-oxazole-3-carboxamide |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)[C@@H](NC(=O)c1cc(-c3ccco3)on1)C2 |
| InChI | InChI=1S/C18H22N2O3/c1-17(2)11-6-7-18(17,3)15(9-11)19-16(21)12-10-14(23-20-12)13-5-4-8-22-13/h4-5,8,10-11,15H,6-7,9H2,1-3H3,(H,19,21)/t11-,15-,18-/m0/s1 |
| InChIKey | CQLXCMFCGMURHQ-GYOIFBIXSA-N |
| XLogP | 3.88 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |