C19H32N2O3 — CID 98786082
ethyl (3R)-1-[[(2R,4aR,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]carbamoyl]piperidine-3-carboxylate (PubChem CID 98786082) has the molecular formula C19H32N2O3 and a molecular weight of 336.48 g/mol. Its IUPAC name is ethyl (3R)-1-[[(2R,4aR,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]carbamoyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[[(2R,4aR,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]carbamoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 98786082 |
| Molecular Formula | C19H32N2O3 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | ethyl (3R)-1-[[(2R,4aR,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]carbamoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(C(=O)N[C@@H]2CC[C@H]3CCCC[C@@H]3C2)C1 |
| InChI | InChI=1S/C19H32N2O3/c1-2-24-18(22)16-8-5-11-21(13-16)19(23)20-17-10-9-14-6-3-4-7-15(14)12-17/h14-17H,2-13H2,1H3,(H,20,23)/t14-,15-,16-,17-/m1/s1 |
| InChIKey | QXKSKDLGDFJWFL-QBPKDAKJSA-N |
| XLogP | 3.33 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |