C22H24N4O4 — CID 98787486
(2R)-2-[(3aR,4R,7R,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]-N-[[4-(imidazol-1-ylmethyl)phenyl]methyl]propanamide (PubChem CID 98787486) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is (2R)-2-[(3aR,4R,7R,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]-N-[[4-(imidazol-1-ylmethyl)phenyl]methyl]propanamide.
| Compound Name | (2R)-2-[(3aR,4R,7R,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]-N-[[4-(imidazol-1-ylmethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 98787486 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | (2R)-2-[(3aR,4R,7R,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]-N-[[4-(imidazol-1-ylmethyl)phenyl]methyl]propanamide |
| SMILES | C[C@H](C(=O)NCc1ccc(Cn2ccnc2)cc1)N1C(=O)[C@@H]2[C@H](C1=O)[C@H]1CC[C@H]2O1 |
| InChI | InChI=1S/C22H24N4O4/c1-13(26-21(28)18-16-6-7-17(30-16)19(18)22(26)29)20(27)24-10-14-2-4-15(5-3-14)11-25-9-8-23-12-25/h2-5,8-9,12-13,16-19H,6-7,10-11H2,1H3,(H,24,27)/t13-,16-,17-,18-,19+/m1/s1 |
| InChIKey | WDSIWXDFUUIQOU-PYJZQUQOSA-N |
| XLogP | 1.10 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|