C18H22F2N2O3S — CID 98854819
(4aS,8aS)-1-cyclopropyl-6-(2,4-difluoro-5-methylphenyl)sulfonyl-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 98854819) has the molecular formula C18H22F2N2O3S and a molecular weight of 384.45 g/mol. Its IUPAC name is (4aS,8aS)-1-cyclopropyl-6-(2,4-difluoro-5-methylphenyl)sulfonyl-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aS)-1-cyclopropyl-6-(2,4-difluoro-5-methylphenyl)sulfonyl-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 98854819 |
| Molecular Formula | C18H22F2N2O3S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | (4aS,8aS)-1-cyclopropyl-6-(2,4-difluoro-5-methylphenyl)sulfonyl-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | Cc1cc(S(=O)(=O)N2CC[C@H]3[C@@H](CCC(=O)N3C3CC3)C2)c(F)cc1F |
| InChI | InChI=1S/C18H22F2N2O3S/c1-11-8-17(15(20)9-14(11)19)26(24,25)21-7-6-16-12(10-21)2-5-18(23)22(16)13-3-4-13/h8-9,12-13,16H,2-7,10H2,1H3/t12-,16-/m0/s1 |
| InChIKey | FZGXRIFNYBNVJO-LRDDRELGSA-N |
| XLogP | 2.44 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |