C18H26BrNO2 — CID 98854990
(1S,2R)-6-bromo-2-methyl-N-[3-[[(3S)-oxolan-3-yl]methoxy]propyl]-2,3-dihydro-1H-inden-1-amine (PubChem CID 98854990) has the molecular formula C18H26BrNO2 and a molecular weight of 368.32 g/mol. Its IUPAC name is (1S,2R)-6-bromo-2-methyl-N-[3-[[(3S)-oxolan-3-yl]methoxy]propyl]-2,3-dihydro-1H-inden-1-amine.
| Compound Name | (1S,2R)-6-bromo-2-methyl-N-[3-[[(3S)-oxolan-3-yl]methoxy]propyl]-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 98854990 |
| Molecular Formula | C18H26BrNO2 |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | (1S,2R)-6-bromo-2-methyl-N-[3-[[(3S)-oxolan-3-yl]methoxy]propyl]-2,3-dihydro-1H-inden-1-amine |
| SMILES | C[C@@H]1Cc2ccc(Br)cc2[C@H]1NCCCOC[C@H]1CCOC1 |
| InChI | InChI=1S/C18H26BrNO2/c1-13-9-15-3-4-16(19)10-17(15)18(13)20-6-2-7-21-11-14-5-8-22-12-14/h3-4,10,13-14,18,20H,2,5-9,11-12H2,1H3/t13-,14-,18+/m1/s1 |
| InChIKey | INOYTRZJPUSKDE-LBTNJELSSA-N |
| XLogP | 3.72 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|