C17H19NOS2 — CID 98872731
(1S,2R,4S)-N-(dithiophen-2-ylmethyl)bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 98872731) has the molecular formula C17H19NOS2 and a molecular weight of 317.48 g/mol. Its IUPAC name is (1S,2R,4S)-N-(dithiophen-2-ylmethyl)bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S,2R,4S)-N-(dithiophen-2-ylmethyl)bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 98872731 |
| Molecular Formula | C17H19NOS2 |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | (1S,2R,4S)-N-(dithiophen-2-ylmethyl)bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | O=C(NC(c1cccs1)c1cccs1)[C@@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C17H19NOS2/c19-17(13-10-11-5-6-12(13)9-11)18-16(14-3-1-7-20-14)15-4-2-8-21-15/h1-4,7-8,11-13,16H,5-6,9-10H2,(H,18,19)/t11-,12-,13+/m0/s1 |
| InChIKey | QPHNPAQOHAOOFV-RWMBFGLXSA-N |
| XLogP | 4.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |