C15H24N4O2S — CID 98895376
N-[7-[(2-methylpyrimidin-5-yl)methyl]-7-azaspiro[3.5]nonan-2-yl]methanesulfonamide (PubChem CID 98895376) has the molecular formula C15H24N4O2S and a molecular weight of 324.45 g/mol. Its IUPAC name is N-[7-[(2-methylpyrimidin-5-yl)methyl]-7-azaspiro[3.5]nonan-2-yl]methanesulfonamide.
| Compound Name | N-[7-[(2-methylpyrimidin-5-yl)methyl]-7-azaspiro[3.5]nonan-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 98895376 |
| Molecular Formula | C15H24N4O2S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | N-[7-[(2-methylpyrimidin-5-yl)methyl]-7-azaspiro[3.5]nonan-2-yl]methanesulfonamide |
| SMILES | Cc1ncc(CN2CCC3(CC2)CC(NS(C)(=O)=O)C3)cn1 |
| InChI | InChI=1S/C15H24N4O2S/c1-12-16-9-13(10-17-12)11-19-5-3-15(4-6-19)7-14(8-15)18-22(2,20)21/h9-10,14,18H,3-8,11H2,1-2H3 |
| InChIKey | WUZFTYJPSQIGHH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |