C17H22N6 — CID 98894753
6-[(2-methylpyrimidin-5-yl)methyl]-N-pyrimidin-2-yl-6-azaspiro[3.4]octan-2-amine (PubChem CID 98894753) has the molecular formula C17H22N6 and a molecular weight of 310.41 g/mol. Its IUPAC name is 6-[(2-methylpyrimidin-5-yl)methyl]-N-pyrimidin-2-yl-6-azaspiro[3.4]octan-2-amine.
| Compound Name | 6-[(2-methylpyrimidin-5-yl)methyl]-N-pyrimidin-2-yl-6-azaspiro[3.4]octan-2-amine |
|---|---|
| PubChem CID | 98894753 |
| Molecular Formula | C17H22N6 |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 6-[(2-methylpyrimidin-5-yl)methyl]-N-pyrimidin-2-yl-6-azaspiro[3.4]octan-2-amine |
| SMILES | Cc1ncc(CN2CCC3(CC(Nc4ncccn4)C3)C2)cn1 |
| InChI | InChI=1S/C17H22N6/c1-13-20-9-14(10-21-13)11-23-6-3-17(12-23)7-15(8-17)22-16-18-4-2-5-19-16/h2,4-5,9-10,15H,3,6-8,11-12H2,1H3,(H,18,19,22) |
| InChIKey | UMIIBBYLJMUZKU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |