C16H20N4S — CID 98894515
N-pyrimidin-2-yl-6-(thiophen-2-ylmethyl)-6-azaspiro[3.4]octan-2-amine (PubChem CID 98894515) has the molecular formula C16H20N4S and a molecular weight of 300.43 g/mol. Its IUPAC name is N-pyrimidin-2-yl-6-(thiophen-2-ylmethyl)-6-azaspiro[3.4]octan-2-amine.
| Compound Name | N-pyrimidin-2-yl-6-(thiophen-2-ylmethyl)-6-azaspiro[3.4]octan-2-amine |
|---|---|
| PubChem CID | 98894515 |
| Molecular Formula | C16H20N4S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | N-pyrimidin-2-yl-6-(thiophen-2-ylmethyl)-6-azaspiro[3.4]octan-2-amine |
| SMILES | c1cnc(NC2CC3(CCN(Cc4cccs4)C3)C2)nc1 |
| InChI | InChI=1S/C16H20N4S/c1-3-14(21-8-1)11-20-7-4-16(12-20)9-13(10-16)19-15-17-5-2-6-18-15/h1-3,5-6,8,13H,4,7,9-12H2,(H,17,18,19) |
| InChIKey | ZEJHADORSRXDCF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |