C12H15F3N4O2S — CID 98894609
N-pyrimidin-2-yl-6-(trifluoromethylsulfonyl)-6-azaspiro[3.4]octan-2-amine (PubChem CID 98894609) has the molecular formula C12H15F3N4O2S and a molecular weight of 336.34 g/mol. Its IUPAC name is N-pyrimidin-2-yl-6-(trifluoromethylsulfonyl)-6-azaspiro[3.4]octan-2-amine.
| Compound Name | N-pyrimidin-2-yl-6-(trifluoromethylsulfonyl)-6-azaspiro[3.4]octan-2-amine |
|---|---|
| PubChem CID | 98894609 |
| Molecular Formula | C12H15F3N4O2S |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | N-pyrimidin-2-yl-6-(trifluoromethylsulfonyl)-6-azaspiro[3.4]octan-2-amine |
| SMILES | O=S(=O)(N1CCC2(CC(Nc3ncccn3)C2)C1)C(F)(F)F |
| InChI | InChI=1S/C12H15F3N4O2S/c13-12(14,15)22(20,21)19-5-2-11(8-19)6-9(7-11)18-10-16-3-1-4-17-10/h1,3-4,9H,2,5-8H2,(H,16,17,18) |
| InChIKey | QOBRNWMQWJCTIE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |