C20H29N3O3 — CID 98895484
(3aR,6S,6aR)-4-[(3-methyl-2-pyridinyl)methyl]-N-(oxan-4-ylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide (PubChem CID 98895484) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is (3aR,6S,6aR)-4-[(3-methyl-2-pyridinyl)methyl]-N-(oxan-4-ylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide.
| Compound Name | (3aR,6S,6aR)-4-[(3-methyl-2-pyridinyl)methyl]-N-(oxan-4-ylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide |
|---|---|
| PubChem CID | 98895484 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | (3aR,6S,6aR)-4-[(3-methyl-2-pyridinyl)methyl]-N-(oxan-4-ylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide |
| SMILES | Cc1cccnc1CN1C[C@H](C(=O)NCC2CCOCC2)[C@H]2OCC[C@H]21 |
| InChI | InChI=1S/C20H29N3O3/c1-14-3-2-7-21-17(14)13-23-12-16(19-18(23)6-10-26-19)20(24)22-11-15-4-8-25-9-5-15/h2-3,7,15-16,18-19H,4-6,8-13H2,1H3,(H,22,24)/t16-,18+,19+/m0/s1 |
| InChIKey | BNAKHNCHXJWFRQ-QXAKKESOSA-N |
| XLogP | 1.52 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |