C11H18BrNO2 — CID 98989522
2-[(1R,3R,4R)-4-bromo-3-hydroxy-2,2-dimethyl-1-bicyclo[2.2.1]heptanyl]acetamide (PubChem CID 98989522) has the molecular formula C11H18BrNO2 and a molecular weight of 276.17 g/mol. Its IUPAC name is 2-[(1R,3R,4R)-4-bromo-3-hydroxy-2,2-dimethyl-1-bicyclo[2.2.1]heptanyl]acetamide.
| Compound Name | 2-[(1R,3R,4R)-4-bromo-3-hydroxy-2,2-dimethyl-1-bicyclo[2.2.1]heptanyl]acetamide |
|---|---|
| PubChem CID | 98989522 |
| Molecular Formula | C11H18BrNO2 |
| Molecular Weight | 276.17 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 2-[(1R,3R,4R)-4-bromo-3-hydroxy-2,2-dimethyl-1-bicyclo[2.2.1]heptanyl]acetamide |
| SMILES | CC1(C)[C@@H](O)[C@@]2(Br)CC[C@@]1(CC(N)=O)C2 |
| InChI | InChI=1S/C11H18BrNO2/c1-9(2)8(15)11(12)4-3-10(9,6-11)5-7(13)14/h8,15H,3-6H2,1-2H3,(H2,13,14)/t8-,10-,11-/m1/s1 |
| InChIKey | FNKWLCQOALFTDB-FBIMIBRVSA-N |
| XLogP | 1.57 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.17 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|