C14H9F3N4OS — CID 99122315
2-(1-methylpyrazol-4-yl)-N-(2,3,4-trifluorophenyl)-1,3-thiazole-5-carboxamide (PubChem CID 99122315) has the molecular formula C14H9F3N4OS and a molecular weight of 338.31 g/mol. Its IUPAC name is 2-(1-methylpyrazol-4-yl)-N-(2,3,4-trifluorophenyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(1-methylpyrazol-4-yl)-N-(2,3,4-trifluorophenyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 99122315 |
| Molecular Formula | C14H9F3N4OS |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 2-(1-methylpyrazol-4-yl)-N-(2,3,4-trifluorophenyl)-1,3-thiazole-5-carboxamide |
| SMILES | Cn1cc(-c2ncc(C(=O)Nc3ccc(F)c(F)c3F)s2)cn1 |
| InChI | InChI=1S/C14H9F3N4OS/c1-21-6-7(4-19-21)14-18-5-10(23-14)13(22)20-9-3-2-8(15)11(16)12(9)17/h2-6H,1H3,(H,20,22) |
| InChIKey | KKMXBIKJEXHVAI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|