C30H35ClO2 — CID 99566840
(5R,8R,9S,10S,13S,14S,16Z)-16-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 99566840) has the molecular formula C30H35ClO2 and a molecular weight of 463.06 g/mol. Its IUPAC name is (5R,8R,9S,10S,13S,14S,16Z)-16-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (5R,8R,9S,10S,13S,14S,16Z)-16-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 99566840 |
| Molecular Formula | C30H35ClO2 |
| Molecular Weight | 463.06 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | (5R,8R,9S,10S,13S,14S,16Z)-16-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CCCC[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)/C(=C\c3ccc(-c4cccc(Cl)c4)o3)C[C@@H]12 |
| InChI | InChI=1S/C30H35ClO2/c1-29-14-4-3-7-21(29)9-11-24-25(29)13-15-30(2)26(24)18-20(28(30)32)17-23-10-12-27(33-23)19-6-5-8-22(31)16-19/h5-6,8,10,12,16-17,21,24-26H,3-4,7,9,11,13-15,18H2,1-2H3/b20-17-/t21-,24-,25+,26+,29+,30+/m1/s1 |
| InChIKey | KRKZQUNPYMHJMV-VHRPACPUSA-N |
| XLogP | 8.60 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.06 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|