C29H42O4S — CID 99571707
[(3S,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] 4-tert-butylbenzenesulfonate (PubChem CID 99571707) has the molecular formula C29H42O4S and a molecular weight of 486.72 g/mol. Its IUPAC name is [(3S,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] 4-tert-butylbenzenesulfonate.
| Compound Name | [(3S,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] 4-tert-butylbenzenesulfonate |
|---|---|
| PubChem CID | 99571707 |
| Molecular Formula | C29H42O4S |
| Molecular Weight | 486.72 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | [(3S,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] 4-tert-butylbenzenesulfonate |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)O[C@H]2CC[C@@]3(C)[C@@H](CC[C@@H]4[C@@H]3CC[C@]3(C)C(=O)CC[C@@H]43)C2)cc1 |
| InChI | InChI=1S/C29H42O4S/c1-27(2,3)19-6-9-22(10-7-19)34(31,32)33-21-14-16-28(4)20(18-21)8-11-23-24-12-13-26(30)29(24,5)17-15-25(23)28/h6-7,9-10,20-21,23-25H,8,11-18H2,1-5H3/t20-,21-,23-,24-,25-,28-,29-/m0/s1 |
| InChIKey | GPJHJVPMQNVLFT-LZTZMLBVSA-N |
| XLogP | 6.67 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.72 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|