C25H30N2O6 — CID 99572880
3-[2-[(8S,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl]-1H-pyrimidine-2,4-dione (PubChem CID 99572880) has the molecular formula C25H30N2O6 and a molecular weight of 454.52 g/mol. Its IUPAC name is 3-[2-[(8S,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 3-[2-[(8S,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 99572880 |
| Molecular Formula | C25H30N2O6 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 3-[2-[(8S,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl]-1H-pyrimidine-2,4-dione |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2C(=O)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)Cn1c(=O)cc[nH]c1=O |
| InChI | InChI=1S/C25H30N2O6/c1-23-8-5-15(28)11-14(23)3-4-16-17-6-9-25(33,24(17,2)12-18(29)21(16)23)19(30)13-27-20(31)7-10-26-22(27)32/h7,10-11,16-17,21,33H,3-6,8-9,12-13H2,1-2H3,(H,26,32)/t16-,17-,21+,23-,24-,25-/m0/s1 |
| InChIKey | XRXBEYJDVHOGHO-CYDKIFNUSA-N |
| XLogP | 1.55 |
| TPSA | 126.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'steroid_A(2)', 'substructure': 'N/A'} |
|---|