C22H29FO3 — CID 99573769
(8S,9R,10S,11R,13S,14S,17S)-17-acetyl-9-fluoro-11-hydroxy-6,10,13-trimethyl-2,8,11,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 99573769) has the molecular formula C22H29FO3 and a molecular weight of 360.47 g/mol. Its IUPAC name is (8S,9R,10S,11R,13S,14S,17S)-17-acetyl-9-fluoro-11-hydroxy-6,10,13-trimethyl-2,8,11,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9R,10S,11R,13S,14S,17S)-17-acetyl-9-fluoro-11-hydroxy-6,10,13-trimethyl-2,8,11,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 99573769 |
| Molecular Formula | C22H29FO3 |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | (8S,9R,10S,11R,13S,14S,17S)-17-acetyl-9-fluoro-11-hydroxy-6,10,13-trimethyl-2,8,11,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3C=C(C)C4=CC(=O)CC[C@]4(C)[C@@]3(F)[C@H](O)C[C@]12C |
| InChI | InChI=1S/C22H29FO3/c1-12-9-18-16-6-5-15(13(2)24)20(16,3)11-19(26)22(18,23)21(4)8-7-14(25)10-17(12)21/h9-10,15-16,18-19,26H,5-8,11H2,1-4H3/t15-,16+,18+,19-,20-,21+,22+/m1/s1 |
| InChIKey | MIMWIEDHKNCDAS-KZHBUWEMSA-N |
| XLogP | 3.95 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |