C22H30F2O2 — CID 99576180
[(1S,2R,7S,9R,11R,12S,15R,16S)-8,8-difluoro-2,16-dimethyl-15-pentacyclo[9.7.0.02,7.07,9.012,16]octadec-5-enyl] acetate (PubChem CID 99576180) has the molecular formula C22H30F2O2 and a molecular weight of 364.48 g/mol. Its IUPAC name is [(1S,2R,7S,9R,11R,12S,15R,16S)-8,8-difluoro-2,16-dimethyl-15-pentacyclo[9.7.0.02,7.07,9.012,16]octadec-5-enyl] acetate.
| Compound Name | [(1S,2R,7S,9R,11R,12S,15R,16S)-8,8-difluoro-2,16-dimethyl-15-pentacyclo[9.7.0.02,7.07,9.012,16]octadec-5-enyl] acetate |
|---|---|
| PubChem CID | 99576180 |
| Molecular Formula | C22H30F2O2 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | [(1S,2R,7S,9R,11R,12S,15R,16S)-8,8-difluoro-2,16-dimethyl-15-pentacyclo[9.7.0.02,7.07,9.012,16]octadec-5-enyl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@H]2[C@@H]3C[C@H]4C(F)(F)[C@@]45C=CCC[C@]5(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C22H30F2O2/c1-13(25)26-18-7-6-15-14-12-17-21(22(17,23)24)10-5-4-9-20(21,3)16(14)8-11-19(15,18)2/h5,10,14-18H,4,6-9,11-12H2,1-3H3/t14-,15-,16-,17+,18+,19-,20+,21-/m0/s1 |
| InChIKey | SGMJHXMWTPRENE-QAQGGTBJSA-N |
| XLogP | 5.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|