C12H19BrN2O2 — CID 99578632
1-(2-bromoprop-2-enyl)-3-[(2R,4S)-2-cyclopropyloxan-4-yl]urea (PubChem CID 99578632) has the molecular formula C12H19BrN2O2 and a molecular weight of 303.20 g/mol. Its IUPAC name is 1-(2-bromoprop-2-enyl)-3-[(2R,4S)-2-cyclopropyloxan-4-yl]urea.
| Compound Name | 1-(2-bromoprop-2-enyl)-3-[(2R,4S)-2-cyclopropyloxan-4-yl]urea |
|---|---|
| PubChem CID | 99578632 |
| Molecular Formula | C12H19BrN2O2 |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 1-(2-bromoprop-2-enyl)-3-[(2R,4S)-2-cyclopropyloxan-4-yl]urea |
| SMILES | C=C(Br)CNC(=O)N[C@H]1CCO[C@@H](C2CC2)C1 |
| InChI | InChI=1S/C12H19BrN2O2/c1-8(13)7-14-12(16)15-10-4-5-17-11(6-10)9-2-3-9/h9-11H,1-7H2,(H2,14,15,16)/t10-,11+/m0/s1 |
| InChIKey | XGVKMKFMXBRAAF-WDEREUQCSA-N |
| XLogP | 2.15 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |