C18H13N3O4 — CID 99584206
N'-(3-ethynylphenyl)-N-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)oxamide (PubChem CID 99584206) has the molecular formula C18H13N3O4 and a molecular weight of 335.32 g/mol. Its IUPAC name is N'-(3-ethynylphenyl)-N-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)oxamide.
| Compound Name | N'-(3-ethynylphenyl)-N-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)oxamide |
|---|---|
| PubChem CID | 99584206 |
| Molecular Formula | C18H13N3O4 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | N'-(3-ethynylphenyl)-N-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)oxamide |
| SMILES | C#Cc1cccc(NC(=O)C(=O)Nc2ccc3oc(=O)n(C)c3c2)c1 |
| InChI | InChI=1S/C18H13N3O4/c1-3-11-5-4-6-12(9-11)19-16(22)17(23)20-13-7-8-15-14(10-13)21(2)18(24)25-15/h1,4-10H,2H3,(H,19,22)(H,20,23) |
| InChIKey | FFYBPNLQYNRLFP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 93.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|