C11H10F3N3OS2 — CID 99591819
N-(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)-2-(2,2,2-trifluoroethylsulfanyl)acetamide (PubChem CID 99591819) has the molecular formula C11H10F3N3OS2 and a molecular weight of 321.35 g/mol. Its IUPAC name is N-(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)-2-(2,2,2-trifluoroethylsulfanyl)acetamide.
| Compound Name | N-(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)-2-(2,2,2-trifluoroethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 99591819 |
| Molecular Formula | C11H10F3N3OS2 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | N-(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)-2-(2,2,2-trifluoroethylsulfanyl)acetamide |
| SMILES | O=C(CSCC(F)(F)F)Nc1ccc2[nH]c(=S)[nH]c2c1 |
| InChI | InChI=1S/C11H10F3N3OS2/c12-11(13,14)5-20-4-9(18)15-6-1-2-7-8(3-6)17-10(19)16-7/h1-3H,4-5H2,(H,15,18)(H2,16,17,19) |
| InChIKey | YKGPLBGBTAUUNG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|