C15H21N5O2S — CID 99604213
N-(5-methyl-1,3-thiazol-2-yl)-N'-[(1R)-1-(1,3,5-trimethylpyrazol-4-yl)propyl]oxamide (PubChem CID 99604213) has the molecular formula C15H21N5O2S and a molecular weight of 335.43 g/mol. Its IUPAC name is N-(5-methyl-1,3-thiazol-2-yl)-N'-[(1R)-1-(1,3,5-trimethylpyrazol-4-yl)propyl]oxamide.
| Compound Name | N-(5-methyl-1,3-thiazol-2-yl)-N'-[(1R)-1-(1,3,5-trimethylpyrazol-4-yl)propyl]oxamide |
|---|---|
| PubChem CID | 99604213 |
| Molecular Formula | C15H21N5O2S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | N-(5-methyl-1,3-thiazol-2-yl)-N'-[(1R)-1-(1,3,5-trimethylpyrazol-4-yl)propyl]oxamide |
| SMILES | CC[C@@H](NC(=O)C(=O)Nc1ncc(C)s1)c1c(C)nn(C)c1C |
| InChI | InChI=1S/C15H21N5O2S/c1-6-11(12-9(3)19-20(5)10(12)4)17-13(21)14(22)18-15-16-7-8(2)23-15/h7,11H,6H2,1-5H3,(H,17,21)(H,16,18,22)/t11-/m1/s1 |
| InChIKey | NYLSCIIJKSJJPU-LLVKDONJSA-N |
| XLogP | 2.01 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|