About N-[(1S)-2,2,2-trifluoro-1-(1-methylpyrrol-3-yl)ethyl]-1-benzofuran-2-sulfonamide
N-[(1S)-2,2,2-trifluoro-1-(1-methylpyrrol-3-yl)ethyl]-1-benzofuran-2-sulfonamide (PubChem CID 99604639) has the molecular formula C15H13F3N2O3S
and a molecular weight of 358.34 g/mol. Its IUPAC name is N-[(1S)-2,2,2-trifluoro-1-(1-methylpyrrol-3-yl)ethyl]-1-benzofuran-2-sulfonamide.
Molecular Properties
| Compound Name | N-[(1S)-2,2,2-trifluoro-1-(1-methylpyrrol-3-yl)ethyl]-1-benzofuran-2-sulfonamide |
| PubChem CID | 99604639 |
| Molecular Formula | C15H13F3N2O3S |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | N-[(1S)-2,2,2-trifluoro-1-(1-methylpyrrol-3-yl)ethyl]-1-benzofuran-2-sulfonamide |
| SMILES | Cn1ccc([C@H](NS(=O)(=O)c2cc3ccccc3o2)C(F)(F)F)c1 |
| InChI | InChI=1S/C15H13F3N2O3S/c1-20-7-6-11(9-20)14(15(16,17)18)19-24(21,22)13-8-10-4-2-3-5-12(10)23-13/h2-9,14,19H,1H3/t14-/m0/s1 |
| InChIKey | OHMWPEDEGLUXFE-AWEZNQCLSA-N |
| XLogP | 3.35 |
| TPSA | 64.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(1S)-2,2,2-trifluoro-1-(1-methylpyrrol-3-yl)ethyl]-1-benzofuran-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S)-2,2,2-trifluoro-1-(1-methylpyrrol-3-yl)ethyl]-1-benzofuran-2-sulfonamide?
The IUPAC name of N-[(1S)-2,2,2-trifluoro-1-(1-methylpyrrol-3-yl)ethyl]-1-benzofuran-2-sulfonamide (CID 99604639) is N-[(1S)-2,2,2-trifluoro-1-(1-methylpyrrol-3-yl)ethyl]-1-benzofuran-2-sulfonamide.
What is the SMILES notation for N-[(1S)-2,2,2-trifluoro-1-(1-methylpyrrol-3-yl)ethyl]-1-benzofuran-2-sulfonamide?
The canonical SMILES for N-[(1S)-2,2,2-trifluoro-1-(1-methylpyrrol-3-yl)ethyl]-1-benzofuran-2-sulfonamide is Cn1ccc([C@H](NS(=O)(=O)c2cc3ccccc3o2)C(F)(F)F)c1.
What is the InChIKey of N-[(1S)-2,2,2-trifluoro-1-(1-methylpyrrol-3-yl)ethyl]-1-benzofuran-2-sulfonamide?
The InChIKey is OHMWPEDEGLUXFE-AWEZNQCLSA-N. The full InChI is InChI=1S/C15H13F3N2O3S/c1-20-7-6-11(9-20)14(15(16,17)18)19-24(21,22)13-8-10-4-2-3-5-12(10)23-13/h2-9,14,19H,1H3/t14-/m0/s1.
What are the key properties of N-[(1S)-2,2,2-trifluoro-1-(1-methylpyrrol-3-yl)ethyl]-1-benzofuran-2-sulfonamide?
N-[(1S)-2,2,2-trifluoro-1-(1-methylpyrrol-3-yl)ethyl]-1-benzofuran-2-sulfonamide has a molecular weight of 358.34 g/mol, XLogP of 3.35, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S)-2,2,2-trifluoro-1-(1-methylpyrrol-3-yl)ethyl]-1-benzofuran-2-sulfonamide is sourced from PubChem (CID 99604639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).