C14H20N2O4S — CID 75387478
N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-1-benzofuran-2-sulfonamide (PubChem CID 75387478) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-1-benzofuran-2-sulfonamide.
| Compound Name | N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-1-benzofuran-2-sulfonamide |
|---|---|
| PubChem CID | 75387478 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-1-benzofuran-2-sulfonamide |
| SMILES | CN(C)CC(C)(O)CNS(=O)(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C14H20N2O4S/c1-14(17,10-16(2)3)9-15-21(18,19)13-8-11-6-4-5-7-12(11)20-13/h4-8,15,17H,9-10H2,1-3H3 |
| InChIKey | QYMOLHBLKPGXHB-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |