C16H19NO5S — CID 167903150
3-(1-benzofuran-2-ylsulfonylamino)-3-cyclobutylbutanoic acid (PubChem CID 167903150) has the molecular formula C16H19NO5S and a molecular weight of 337.40 g/mol. Its IUPAC name is 3-(1-benzofuran-2-ylsulfonylamino)-3-cyclobutylbutanoic acid.
| Compound Name | 3-(1-benzofuran-2-ylsulfonylamino)-3-cyclobutylbutanoic acid |
|---|---|
| PubChem CID | 167903150 |
| Molecular Formula | C16H19NO5S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 3-(1-benzofuran-2-ylsulfonylamino)-3-cyclobutylbutanoic acid |
| SMILES | CC(CC(=O)O)(NS(=O)(=O)c1cc2ccccc2o1)C1CCC1 |
| InChI | InChI=1S/C16H19NO5S/c1-16(10-14(18)19,12-6-4-7-12)17-23(20,21)15-9-11-5-2-3-8-13(11)22-15/h2-3,5,8-9,12,17H,4,6-7,10H2,1H3,(H,18,19) |
| InChIKey | SASJIYIVCRRCGA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |