C14H18FN5OS — CID 99604817
4-fluoro-N-methyl-3-(methylsulfanylmethyl)-N-[(2R)-2-(2H-tetrazol-5-yl)propyl]benzamide (PubChem CID 99604817) has the molecular formula C14H18FN5OS and a molecular weight of 323.40 g/mol. Its IUPAC name is 4-fluoro-N-methyl-3-(methylsulfanylmethyl)-N-[(2R)-2-(2H-tetrazol-5-yl)propyl]benzamide.
| Compound Name | 4-fluoro-N-methyl-3-(methylsulfanylmethyl)-N-[(2R)-2-(2H-tetrazol-5-yl)propyl]benzamide |
|---|---|
| PubChem CID | 99604817 |
| Molecular Formula | C14H18FN5OS |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 4-fluoro-N-methyl-3-(methylsulfanylmethyl)-N-[(2R)-2-(2H-tetrazol-5-yl)propyl]benzamide |
| SMILES | CSCc1cc(C(=O)N(C)C[C@@H](C)c2nn[nH]n2)ccc1F |
| InChI | InChI=1S/C14H18FN5OS/c1-9(13-16-18-19-17-13)7-20(2)14(21)10-4-5-12(15)11(6-10)8-22-3/h4-6,9H,7-8H2,1-3H3,(H,16,17,18,19)/t9-/m1/s1 |
| InChIKey | JTMRNJZPFYGJTH-SECBINFHSA-N |
| XLogP | 2.08 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |