C20H19N3O2S — CID 99609477
methyl (2S)-2-phenyl-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetate (PubChem CID 99609477) has the molecular formula C20H19N3O2S and a molecular weight of 365.46 g/mol. Its IUPAC name is methyl (2S)-2-phenyl-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetate.
| Compound Name | methyl (2S)-2-phenyl-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 99609477 |
| Molecular Formula | C20H19N3O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | methyl (2S)-2-phenyl-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetate |
| SMILES | C=CCn1c(S[C@H](C(=O)OC)c2ccccc2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C20H19N3O2S/c1-3-14-23-18(16-12-8-5-9-13-16)21-22-20(23)26-17(19(24)25-2)15-10-6-4-7-11-15/h3-13,17H,1,14H2,2H3/t17-/m0/s1 |
| InChIKey | WWRDWMPZBSMRLB-KRWDZBQOSA-N |
| XLogP | 4.14 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|