About N-(2,6-dimethyl-3-pyridinyl)-N'-[(2R)-3-methyl-3-phenylbutan-2-yl]oxamide
N-(2,6-dimethyl-3-pyridinyl)-N'-[(2R)-3-methyl-3-phenylbutan-2-yl]oxamide (PubChem CID 99616588) has the molecular formula C20H25N3O2
and a molecular weight of 339.44 g/mol. Its IUPAC name is N-(2,6-dimethyl-3-pyridinyl)-N'-[(2R)-3-methyl-3-phenylbutan-2-yl]oxamide.
Molecular Properties
| Compound Name | N-(2,6-dimethyl-3-pyridinyl)-N'-[(2R)-3-methyl-3-phenylbutan-2-yl]oxamide |
| PubChem CID | 99616588 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | N-(2,6-dimethyl-3-pyridinyl)-N'-[(2R)-3-methyl-3-phenylbutan-2-yl]oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)N[C@H](C)C(C)(C)c2ccccc2)c(C)n1 |
| InChI | InChI=1S/C20H25N3O2/c1-13-11-12-17(14(2)21-13)23-19(25)18(24)22-15(3)20(4,5)16-9-7-6-8-10-16/h6-12,15H,1-5H3,(H,22,24)(H,23,25)/t15-/m1/s1 |
| InChIKey | LSLDQBQHKUCPIJ-OAHLLOKOSA-N |
| XLogP | 3.12 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2,6-dimethyl-3-pyridinyl)-N'-[(2R)-3-methyl-3-phenylbutan-2-yl]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-dimethyl-3-pyridinyl)-N'-[(2R)-3-methyl-3-phenylbutan-2-yl]oxamide?
The IUPAC name of N-(2,6-dimethyl-3-pyridinyl)-N'-[(2R)-3-methyl-3-phenylbutan-2-yl]oxamide (CID 99616588) is N-(2,6-dimethyl-3-pyridinyl)-N'-[(2R)-3-methyl-3-phenylbutan-2-yl]oxamide.
What is the SMILES notation for N-(2,6-dimethyl-3-pyridinyl)-N'-[(2R)-3-methyl-3-phenylbutan-2-yl]oxamide?
The canonical SMILES for N-(2,6-dimethyl-3-pyridinyl)-N'-[(2R)-3-methyl-3-phenylbutan-2-yl]oxamide is Cc1ccc(NC(=O)C(=O)N[C@H](C)C(C)(C)c2ccccc2)c(C)n1.
What is the InChIKey of N-(2,6-dimethyl-3-pyridinyl)-N'-[(2R)-3-methyl-3-phenylbutan-2-yl]oxamide?
The InChIKey is LSLDQBQHKUCPIJ-OAHLLOKOSA-N. The full InChI is InChI=1S/C20H25N3O2/c1-13-11-12-17(14(2)21-13)23-19(25)18(24)22-15(3)20(4,5)16-9-7-6-8-10-16/h6-12,15H,1-5H3,(H,22,24)(H,23,25)/t15-/m1/s1.
What are the key properties of N-(2,6-dimethyl-3-pyridinyl)-N'-[(2R)-3-methyl-3-phenylbutan-2-yl]oxamide?
N-(2,6-dimethyl-3-pyridinyl)-N'-[(2R)-3-methyl-3-phenylbutan-2-yl]oxamide has a molecular weight of 339.44 g/mol, XLogP of 3.12, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-dimethyl-3-pyridinyl)-N'-[(2R)-3-methyl-3-phenylbutan-2-yl]oxamide is sourced from PubChem (CID 99616588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).