C10H17F3N2O2 — CID 99621932
1-[(1S)-1-cyclopentyl-2,2,2-trifluoroethyl]-3-ethoxyurea (PubChem CID 99621932) has the molecular formula C10H17F3N2O2 and a molecular weight of 254.25 g/mol. Its IUPAC name is 1-[(1S)-1-cyclopentyl-2,2,2-trifluoroethyl]-3-ethoxyurea.
| Compound Name | 1-[(1S)-1-cyclopentyl-2,2,2-trifluoroethyl]-3-ethoxyurea |
|---|---|
| PubChem CID | 99621932 |
| Molecular Formula | C10H17F3N2O2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 1-[(1S)-1-cyclopentyl-2,2,2-trifluoroethyl]-3-ethoxyurea |
| SMILES | CCONC(=O)N[C@@H](C1CCCC1)C(F)(F)F |
| InChI | InChI=1S/C10H17F3N2O2/c1-2-17-15-9(16)14-8(10(11,12)13)7-5-3-4-6-7/h7-8H,2-6H2,1H3,(H2,14,15,16)/t8-/m0/s1 |
| InChIKey | GLAFSZSEEJHMST-QMMMGPOBSA-N |
| XLogP | 2.36 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|