C16H23F2N3O2 — CID 99626997
(3R)-N-[2-(2,4-difluorophenoxy)ethyl]-3-[(dimethylamino)methyl]pyrrolidine-1-carboxamide (PubChem CID 99626997) has the molecular formula C16H23F2N3O2 and a molecular weight of 327.38 g/mol. Its IUPAC name is (3R)-N-[2-(2,4-difluorophenoxy)ethyl]-3-[(dimethylamino)methyl]pyrrolidine-1-carboxamide.
| Compound Name | (3R)-N-[2-(2,4-difluorophenoxy)ethyl]-3-[(dimethylamino)methyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 99626997 |
| Molecular Formula | C16H23F2N3O2 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | (3R)-N-[2-(2,4-difluorophenoxy)ethyl]-3-[(dimethylamino)methyl]pyrrolidine-1-carboxamide |
| SMILES | CN(C)C[C@H]1CCN(C(=O)NCCOc2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C16H23F2N3O2/c1-20(2)10-12-5-7-21(11-12)16(22)19-6-8-23-15-4-3-13(17)9-14(15)18/h3-4,9,12H,5-8,10-11H2,1-2H3,(H,19,22)/t12-/m1/s1 |
| InChIKey | FSYGWZQZSYBOER-GFCCVEGCSA-N |
| XLogP | 1.94 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|